C28H26F6N4O3 — CID 87933098
3-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-[[(2R,4S)-2-ethyl-6-methoxy-1,2,3,4-tetrahydroquinolin-4-yl]amino]pyrimidin-5-yl]prop-2-enoic acid (PubChem CID 87933098) has the molecular formula C28H26F6N4O3 and a molecular weight of 580.53 g/mol. Its IUPAC name is 3-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-[[(2R,4S)-2-ethyl-6-methoxy-1,2,3,4-tetrahydroquinolin-4-yl]amino]pyrimidin-5-yl]prop-2-enoic acid.
| Compound Name | 3-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-[[(2R,4S)-2-ethyl-6-methoxy-1,2,3,4-tetrahydroquinolin-4-yl]amino]pyrimidin-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 87933098 |
| Molecular Formula | C28H26F6N4O3 |
| Molecular Weight | 580.53 g/mol |
| Exact Mass | 580.19 |
| IUPAC Name | 3-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-[[(2R,4S)-2-ethyl-6-methoxy-1,2,3,4-tetrahydroquinolin-4-yl]amino]pyrimidin-5-yl]prop-2-enoic acid |
| SMILES | CC[C@@H]1C[C@H](Nc2ncc(C=CC(=O)O)c(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)c2cc(OC)ccc2N1 |
| InChI | InChI=1S/C28H26F6N4O3/c1-3-19-12-24(21-13-20(41-2)5-6-22(21)36-19)38-26-35-14-16(4-7-25(39)40)23(37-26)10-15-8-17(27(29,30)31)11-18(9-15)28(32,33)34/h4-9,11,13-14,19,24,36H,3,10,12H2,1-2H3,(H,39,40)(H,35,37,38)/t19-,24+/m1/s1 |
| InChIKey | MOLGQMUEMDZGHL-DVECYGJZSA-N |
| XLogP | 6.96 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.53 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|