About N,N-di(propan-2-yl)propan-2-amine;N-propan-2-ylpropan-2-amine
N,N-di(propan-2-yl)propan-2-amine;N-propan-2-ylpropan-2-amine (PubChem CID 87933186) has the molecular formula C15H36N2
and a molecular weight of 244.47 g/mol. Its IUPAC name is N,N-di(propan-2-yl)propan-2-amine;N-propan-2-ylpropan-2-amine.
Molecular Properties
| Compound Name | N,N-di(propan-2-yl)propan-2-amine;N-propan-2-ylpropan-2-amine |
| PubChem CID | 87933186 |
| Molecular Formula | C15H36N2 |
| Molecular Weight | 244.47 g/mol |
| Exact Mass | 244.29 |
| IUPAC Name | N,N-di(propan-2-yl)propan-2-amine;N-propan-2-ylpropan-2-amine |
| SMILES | CC(C)N(C(C)C)C(C)C.CC(C)NC(C)C |
| InChI | InChI=1S/C9H21N.C6H15N/c1-7(2)10(8(3)4)9(5)6;1-5(2)7-6(3)4/h7-9H,1-6H3;5-7H,1-4H3 |
| InChIKey | QTIBULYOKJQTMU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-di(propan-2-yl)propan-2-amine;N-propan-2-ylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-di(propan-2-yl)propan-2-amine;N-propan-2-ylpropan-2-amine?
The IUPAC name of N,N-di(propan-2-yl)propan-2-amine;N-propan-2-ylpropan-2-amine (CID 87933186) is N,N-di(propan-2-yl)propan-2-amine;N-propan-2-ylpropan-2-amine.
What is the SMILES notation for N,N-di(propan-2-yl)propan-2-amine;N-propan-2-ylpropan-2-amine?
The canonical SMILES for N,N-di(propan-2-yl)propan-2-amine;N-propan-2-ylpropan-2-amine is CC(C)N(C(C)C)C(C)C.CC(C)NC(C)C.
What is the InChIKey of N,N-di(propan-2-yl)propan-2-amine;N-propan-2-ylpropan-2-amine?
The InChIKey is QTIBULYOKJQTMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N.C6H15N/c1-7(2)10(8(3)4)9(5)6;1-5(2)7-6(3)4/h7-9H,1-6H3;5-7H,1-4H3.
What are the key properties of N,N-di(propan-2-yl)propan-2-amine;N-propan-2-ylpropan-2-amine?
N,N-di(propan-2-yl)propan-2-amine;N-propan-2-ylpropan-2-amine has a molecular weight of 244.47 g/mol, XLogP of 3.91, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-di(propan-2-yl)propan-2-amine;N-propan-2-ylpropan-2-amine is sourced from PubChem (CID 87933186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).