About trimethoxy-(2,3,3-trifluoro-1-iodopropyl)silane
trimethoxy-(2,3,3-trifluoro-1-iodopropyl)silane (PubChem CID 87933422) has the molecular formula C6H12F3IO3Si
and a molecular weight of 344.14 g/mol. Its IUPAC name is trimethoxy-(2,3,3-trifluoro-1-iodopropyl)silane.
Molecular Properties
| Compound Name | trimethoxy-(2,3,3-trifluoro-1-iodopropyl)silane |
| PubChem CID | 87933422 |
| Molecular Formula | C6H12F3IO3Si |
| Molecular Weight | 344.14 g/mol |
| Exact Mass | 343.96 |
| IUPAC Name | trimethoxy-(2,3,3-trifluoro-1-iodopropyl)silane |
| SMILES | CO[Si](OC)(OC)C(I)C(F)C(F)F |
| InChI | InChI=1S/C6H12F3IO3Si/c1-11-14(12-2,13-3)6(10)4(7)5(8)9/h4-6H,1-3H3 |
| InChIKey | QVDCHFRQVGMCFR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.14 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze trimethoxy-(2,3,3-trifluoro-1-iodopropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethoxy-(2,3,3-trifluoro-1-iodopropyl)silane?
The IUPAC name of trimethoxy-(2,3,3-trifluoro-1-iodopropyl)silane (CID 87933422) is trimethoxy-(2,3,3-trifluoro-1-iodopropyl)silane.
What is the SMILES notation for trimethoxy-(2,3,3-trifluoro-1-iodopropyl)silane?
The canonical SMILES for trimethoxy-(2,3,3-trifluoro-1-iodopropyl)silane is CO[Si](OC)(OC)C(I)C(F)C(F)F.
What is the InChIKey of trimethoxy-(2,3,3-trifluoro-1-iodopropyl)silane?
The InChIKey is QVDCHFRQVGMCFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12F3IO3Si/c1-11-14(12-2,13-3)6(10)4(7)5(8)9/h4-6H,1-3H3.
What are the key properties of trimethoxy-(2,3,3-trifluoro-1-iodopropyl)silane?
trimethoxy-(2,3,3-trifluoro-1-iodopropyl)silane has a molecular weight of 344.14 g/mol, XLogP of 1.81, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trimethoxy-(2,3,3-trifluoro-1-iodopropyl)silane is sourced from PubChem (CID 87933422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).