C12H10F14 — CID 87933698
1,1,1,2,8,9,9,9-octafluoro-4-methylidene-2,8-bis(trifluoromethyl)nonane (PubChem CID 87933698) has the molecular formula C12H10F14 and a molecular weight of 420.18 g/mol. Its IUPAC name is 1,1,1,2,8,9,9,9-octafluoro-4-methylidene-2,8-bis(trifluoromethyl)nonane.
| Compound Name | 1,1,1,2,8,9,9,9-octafluoro-4-methylidene-2,8-bis(trifluoromethyl)nonane |
|---|---|
| PubChem CID | 87933698 |
| Molecular Formula | C12H10F14 |
| Molecular Weight | 420.18 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 1,1,1,2,8,9,9,9-octafluoro-4-methylidene-2,8-bis(trifluoromethyl)nonane |
| SMILES | C=C(CCCC(F)(C(F)(F)F)C(F)(F)F)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H10F14/c1-6(5-8(14,11(21,22)23)12(24,25)26)3-2-4-7(13,9(15,16)17)10(18,19)20/h1-5H2 |
| InChIKey | QVNMOBABHXLBAT-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.18 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|