C22H25FN3O5+ — CID 87934519
1-[(4-fluorophenyl)methyl]-4-hydroxy-N-(2-hydroxypropyl)-1-(3-hydroxypropyl)-2-oxo-1,5-naphthyridin-1-ium-3-carboxamide (PubChem CID 87934519) has the molecular formula C22H25FN3O5+ and a molecular weight of 430.46 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-4-hydroxy-N-(2-hydroxypropyl)-1-(3-hydroxypropyl)-2-oxo-1,5-naphthyridin-1-ium-3-carboxamide.
| Compound Name | 1-[(4-fluorophenyl)methyl]-4-hydroxy-N-(2-hydroxypropyl)-1-(3-hydroxypropyl)-2-oxo-1,5-naphthyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 87934519 |
| Molecular Formula | C22H25FN3O5+ |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-4-hydroxy-N-(2-hydroxypropyl)-1-(3-hydroxypropyl)-2-oxo-1,5-naphthyridin-1-ium-3-carboxamide |
| SMILES | CC(O)CNC(=O)C1=C(O)c2ncccc2[N+](CCCO)(Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C22H24FN3O5/c1-14(28)12-25-21(30)18-20(29)19-17(4-2-9-24-19)26(22(18)31,10-3-11-27)13-15-5-7-16(23)8-6-15/h2,4-9,14,27-28H,3,10-13H2,1H3,(H-,25,29,30,31)/p+1 |
| InChIKey | AUQXCGKMRKCRIZ-UHFFFAOYSA-O |
| XLogP | 1.42 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|