About CID 87935972
CID 87935972 (PubChem CID 87935972) has the molecular formula C22H30NO2Si2Zr-
and a molecular weight of 487.88 g/mol.
Molecular Properties
| Compound Name | CID 87935972 |
| PubChem CID | 87935972 |
| Molecular Formula | C22H30NO2Si2Zr- |
| Molecular Weight | 487.88 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | — |
| SMILES | CO[Si]1(C)c2c(NC(C)(C)C)c(O[Si](C)(C)C)c3c([cH-]c4ccccc43)c21.[Zr] |
| InChI | InChI=1S/C22H30NO2Si2.Zr/c1-22(2,3)23-18-19(25-26(5,6)7)17-15-12-10-9-11-14(15)13-16(17)20-21(18)27(20,8)24-4;/h9-13,23H,1-8H3;/q-1; |
| InChIKey | GQLLHNYOSSYDFS-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 487.88 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87935972 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87935972?
The IUPAC name of CID 87935972 (CID 87935972) is not available.
What is the SMILES notation for CID 87935972?
The canonical SMILES for CID 87935972 is CO[Si]1(C)c2c(NC(C)(C)C)c(O[Si](C)(C)C)c3c([cH-]c4ccccc43)c21.[Zr].
What is the InChIKey of CID 87935972?
The InChIKey is GQLLHNYOSSYDFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30NO2Si2.Zr/c1-22(2,3)23-18-19(25-26(5,6)7)17-15-12-10-9-11-14(15)13-16(17)20-21(18)27(20,8)24-4;/h9-13,23H,1-8H3;/q-1;.
What are the key properties of CID 87935972?
CID 87935972 has a molecular weight of 487.88 g/mol, XLogP of 4.78, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87935972 is sourced from PubChem (CID 87935972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).