C15H21O2SiZr- — CID 87936103
2-(2-cyclopenta-1,4-dien-1-ylcyclopenta-1,4-dien-1-yl)oxyethoxy-trimethylsilane;zirconium (PubChem CID 87936103) has the molecular formula C15H21O2SiZr- and a molecular weight of 352.64 g/mol. Its IUPAC name is 2-(2-cyclopenta-1,4-dien-1-ylcyclopenta-1,4-dien-1-yl)oxyethoxy-trimethylsilane;zirconium.
| Compound Name | 2-(2-cyclopenta-1,4-dien-1-ylcyclopenta-1,4-dien-1-yl)oxyethoxy-trimethylsilane;zirconium |
|---|---|
| PubChem CID | 87936103 |
| Molecular Formula | C15H21O2SiZr- |
| Molecular Weight | 352.64 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 2-(2-cyclopenta-1,4-dien-1-ylcyclopenta-1,4-dien-1-yl)oxyethoxy-trimethylsilane;zirconium |
| SMILES | C[Si](C)(C)OCCOC1=C(C2=[C-]CC=C2)CC=C1.[Zr] |
| InChI | InChI=1S/C15H21O2Si.Zr/c1-18(2,3)17-12-11-16-15-10-6-9-14(15)13-7-4-5-8-13;/h4,6-7,10H,5,9,11-12H2,1-3H3;/q-1; |
| InChIKey | QLQGUFVSBJWTAF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.64 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|