About 2-(2-cyclopenta-1,4-dien-1-yl-1H-inden-1-yl)ethoxy-trimethylsilane;zirconium
2-(2-cyclopenta-1,4-dien-1-yl-1H-inden-1-yl)ethoxy-trimethylsilane;zirconium (PubChem CID 87936755) has the molecular formula C19H23OSiZr-
and a molecular weight of 386.70 g/mol. Its IUPAC name is 2-(2-cyclopenta-1,4-dien-1-yl-1H-inden-1-yl)ethoxy-trimethylsilane;zirconium.
Molecular Properties
| Compound Name | 2-(2-cyclopenta-1,4-dien-1-yl-1H-inden-1-yl)ethoxy-trimethylsilane;zirconium |
| PubChem CID | 87936755 |
| Molecular Formula | C19H23OSiZr- |
| Molecular Weight | 386.70 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 2-(2-cyclopenta-1,4-dien-1-yl-1H-inden-1-yl)ethoxy-trimethylsilane;zirconium |
| SMILES | C[Si](C)(C)OCCC1C(C2=[C-]CC=C2)=Cc2ccccc21.[Zr] |
| InChI | InChI=1S/C19H23OSi.Zr/c1-21(2,3)20-13-12-18-17-11-7-6-10-16(17)14-19(18)15-8-4-5-9-15;/h4,6-8,10-11,14,18H,5,12-13H2,1-3H3;/q-1; |
| InChIKey | CIAMFMLJZFICNL-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.70 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-cyclopenta-1,4-dien-1-yl-1H-inden-1-yl)ethoxy-trimethylsilane;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-cyclopenta-1,4-dien-1-yl-1H-inden-1-yl)ethoxy-trimethylsilane;zirconium?
The IUPAC name of 2-(2-cyclopenta-1,4-dien-1-yl-1H-inden-1-yl)ethoxy-trimethylsilane;zirconium (CID 87936755) is 2-(2-cyclopenta-1,4-dien-1-yl-1H-inden-1-yl)ethoxy-trimethylsilane;zirconium.
What is the SMILES notation for 2-(2-cyclopenta-1,4-dien-1-yl-1H-inden-1-yl)ethoxy-trimethylsilane;zirconium?
The canonical SMILES for 2-(2-cyclopenta-1,4-dien-1-yl-1H-inden-1-yl)ethoxy-trimethylsilane;zirconium is C[Si](C)(C)OCCC1C(C2=[C-]CC=C2)=Cc2ccccc21.[Zr].
What is the InChIKey of 2-(2-cyclopenta-1,4-dien-1-yl-1H-inden-1-yl)ethoxy-trimethylsilane;zirconium?
The InChIKey is CIAMFMLJZFICNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23OSi.Zr/c1-21(2,3)20-13-12-18-17-11-7-6-10-16(17)14-19(18)15-8-4-5-9-15;/h4,6-8,10-11,14,18H,5,12-13H2,1-3H3;/q-1;.
What are the key properties of 2-(2-cyclopenta-1,4-dien-1-yl-1H-inden-1-yl)ethoxy-trimethylsilane;zirconium?
2-(2-cyclopenta-1,4-dien-1-yl-1H-inden-1-yl)ethoxy-trimethylsilane;zirconium has a molecular weight of 386.70 g/mol, XLogP of 5.10, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-cyclopenta-1,4-dien-1-yl-1H-inden-1-yl)ethoxy-trimethylsilane;zirconium is sourced from PubChem (CID 87936755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).