C26H39NO6S — CID 87937689
3,3-dimethoxy-2-phenyl-6-propyl-4,5-dihydro-2H-pyridine;(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid (PubChem CID 87937689) has the molecular formula C26H39NO6S and a molecular weight of 493.67 g/mol. Its IUPAC name is 3,3-dimethoxy-2-phenyl-6-propyl-4,5-dihydro-2H-pyridine;(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid.
| Compound Name | 3,3-dimethoxy-2-phenyl-6-propyl-4,5-dihydro-2H-pyridine;(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid |
|---|---|
| PubChem CID | 87937689 |
| Molecular Formula | C26H39NO6S |
| Molecular Weight | 493.67 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | 3,3-dimethoxy-2-phenyl-6-propyl-4,5-dihydro-2H-pyridine;(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2.CCCC1=NC(c2ccccc2)C(OC)(OC)CC1 |
| InChI | InChI=1S/C16H23NO2.C10H16O4S/c1-4-8-14-11-12-16(18-2,19-3)15(17-14)13-9-6-5-7-10-13;1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h5-7,9-10,15H,4,8,11-12H2,1-3H3;7H,3-6H2,1-2H3,(H,12,13,14) |
| InChIKey | QHRUOKGEUFJBMX-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.67 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|