C15H10F5NO3S — CID 87938631
2,3,4,5,6-pentafluoro-N-[3-hydroxy-4-[(Z)-prop-1-enyl]phenyl]benzenesulfonamide (PubChem CID 87938631) has the molecular formula C15H10F5NO3S and a molecular weight of 379.31 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[3-hydroxy-4-[(Z)-prop-1-enyl]phenyl]benzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[3-hydroxy-4-[(Z)-prop-1-enyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 87938631 |
| Molecular Formula | C15H10F5NO3S |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[3-hydroxy-4-[(Z)-prop-1-enyl]phenyl]benzenesulfonamide |
| SMILES | C/C=C\c1ccc(NS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1O |
| InChI | InChI=1S/C15H10F5NO3S/c1-2-3-7-4-5-8(6-9(7)22)21-25(23,24)15-13(19)11(17)10(16)12(18)14(15)20/h2-6,21-22H,1H3/b3-2- |
| InChIKey | LHBVUBQHECBQIJ-IHWYPQMZSA-N |
| XLogP | 3.92 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|