About 5-ethynyl-10,20-diheptyl-15-(1-methylimidazol-2-yl)porphyrin
5-ethynyl-10,20-diheptyl-15-(1-methylimidazol-2-yl)porphyrin (PubChem CID 87940193) has the molecular formula C40H44N6
and a molecular weight of 608.83 g/mol. Its IUPAC name is 5-ethynyl-10,20-diheptyl-15-(1-methylimidazol-2-yl)porphyrin.
Molecular Properties
| Compound Name | 5-ethynyl-10,20-diheptyl-15-(1-methylimidazol-2-yl)porphyrin |
| PubChem CID | 87940193 |
| Molecular Formula | C40H44N6 |
| Molecular Weight | 608.83 g/mol |
| Exact Mass | 608.36 |
| IUPAC Name | 5-ethynyl-10,20-diheptyl-15-(1-methylimidazol-2-yl)porphyrin |
| SMILES | C#C/C1=C2\C=CC(=N2)/C(CCCCCCC)=C2/C=CC(=N2)/C(c2nccn2C)=C2/C=CC(=N2)/C(CCCCCCC)=C2/C=CC1=N2 |
| InChI | InChI=1S/C40H44N6/c1-5-8-10-12-14-16-29-33-20-18-31(42-33)28(7-3)32-19-21-34(43-32)30(17-15-13-11-9-6-2)36-23-25-38(45-36)39(37-24-22-35(29)44-37)40-41-26-27-46(40)4/h3,18-27H,5-6,8-17H2,1-2,4H3/b31-28-,32-28-,33-29-,34-30-,35-29-,36-30-,39-37+,39-38+ |
| InChIKey | GQLCGTKYPLNAGL-FCDHBEMGSA-N |
| XLogP | 9.30 |
| TPSA | 67.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 608.83 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethynyl-10,20-diheptyl-15-(1-methylimidazol-2-yl)porphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethynyl-10,20-diheptyl-15-(1-methylimidazol-2-yl)porphyrin?
The IUPAC name of 5-ethynyl-10,20-diheptyl-15-(1-methylimidazol-2-yl)porphyrin (CID 87940193) is 5-ethynyl-10,20-diheptyl-15-(1-methylimidazol-2-yl)porphyrin.
What is the SMILES notation for 5-ethynyl-10,20-diheptyl-15-(1-methylimidazol-2-yl)porphyrin?
The canonical SMILES for 5-ethynyl-10,20-diheptyl-15-(1-methylimidazol-2-yl)porphyrin is C#C/C1=C2\C=CC(=N2)/C(CCCCCCC)=C2/C=CC(=N2)/C(c2nccn2C)=C2/C=CC(=N2)/C(CCCCCCC)=C2/C=CC1=N2.
What is the InChIKey of 5-ethynyl-10,20-diheptyl-15-(1-methylimidazol-2-yl)porphyrin?
The InChIKey is GQLCGTKYPLNAGL-FCDHBEMGSA-N. The full InChI is InChI=1S/C40H44N6/c1-5-8-10-12-14-16-29-33-20-18-31(42-33)28(7-3)32-19-21-34(43-32)30(17-15-13-11-9-6-2)36-23-25-38(45-36)39(37-24-22-35(29)44-37)40-41-26-27-46(40)4/h3,18-27H,5-6,8-17H2,1-2,4H3/b31-28-,32-28-,33-29-,34-30-,35-29-,36-30-,39-37+,39-38+.
What are the key properties of 5-ethynyl-10,20-diheptyl-15-(1-methylimidazol-2-yl)porphyrin?
5-ethynyl-10,20-diheptyl-15-(1-methylimidazol-2-yl)porphyrin has a molecular weight of 608.83 g/mol, XLogP of 9.30, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethynyl-10,20-diheptyl-15-(1-methylimidazol-2-yl)porphyrin is sourced from PubChem (CID 87940193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).