C26H27F2N3O8S — CID 87940237
[(2S)-6-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methanol;[(2S)-6-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methyl 4-nitrobenzenesulfonate (PubChem CID 87940237) has the molecular formula C26H27F2N3O8S and a molecular weight of 579.58 g/mol. Its IUPAC name is [(2S)-6-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methanol;[(2S)-6-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methyl 4-nitrobenzenesulfonate.
| Compound Name | [(2S)-6-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methanol;[(2S)-6-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methyl 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 87940237 |
| Molecular Formula | C26H27F2N3O8S |
| Molecular Weight | 579.58 g/mol |
| Exact Mass | 579.15 |
| IUPAC Name | [(2S)-6-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methanol;[(2S)-6-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methyl 4-nitrobenzenesulfonate |
| SMILES | CN1C[C@@H](CO)Oc2ccc(F)cc21.CN1C[C@@H](COS(=O)(=O)c2ccc([N+](=O)[O-])cc2)Oc2ccc(F)cc21 |
| InChI | InChI=1S/C16H15FN2O6S.C10H12FNO2/c1-18-9-13(25-16-7-2-11(17)8-15(16)18)10-24-26(22,23)14-5-3-12(4-6-14)19(20)21;1-12-5-8(6-13)14-10-3-2-7(11)4-9(10)12/h2-8,13H,9-10H2,1H3;2-4,8,13H,5-6H2,1H3/t13-;8-/m00/s1 |
| InChIKey | SGYMIFSRMUVRSG-GIZSYDTJSA-N |
| XLogP | 3.35 |
| TPSA | 131.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.58 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|