C44H54N6Si — CID 87940371
1-[10,20-diheptyl-15-(1-methylimidazol-2-yl)porphyrin-5-yl]prop-2-ynyl-trimethylsilane (PubChem CID 87940371) has the molecular formula C44H54N6Si and a molecular weight of 695.04 g/mol. Its IUPAC name is 1-[10,20-diheptyl-15-(1-methylimidazol-2-yl)porphyrin-5-yl]prop-2-ynyl-trimethylsilane.
| Compound Name | 1-[10,20-diheptyl-15-(1-methylimidazol-2-yl)porphyrin-5-yl]prop-2-ynyl-trimethylsilane |
|---|---|
| PubChem CID | 87940371 |
| Molecular Formula | C44H54N6Si |
| Molecular Weight | 695.04 g/mol |
| Exact Mass | 694.42 |
| IUPAC Name | 1-[10,20-diheptyl-15-(1-methylimidazol-2-yl)porphyrin-5-yl]prop-2-ynyl-trimethylsilane |
| SMILES | C#CC(/C1=C2\C=CC(=N2)/C(CCCCCCC)=C2/C=CC(=N2)/C(c2nccn2C)=C2/C=CC(=N2)/C(CCCCCCC)=C2/C=CC1=N2)[Si](C)(C)C |
| InChI | InChI=1S/C44H54N6Si/c1-8-11-13-15-17-19-31-33-21-25-37(46-33)42(41(10-3)51(5,6)7)38-26-22-34(47-38)32(20-18-16-14-12-9-2)36-24-28-40(49-36)43(39-27-23-35(31)48-39)44-45-29-30-50(44)4/h3,21-30,41H,8-9,11-20H2,1-2,4-7H3/b33-31-,34-32-,35-31-,36-32-,42-37+,42-38+,43-39+,43-40+ |
| InChIKey | CGTIWJIMXBVLEK-PRAUSDEWSA-N |
| XLogP | 11.01 |
| TPSA | 67.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.04 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|