About sodium;3,5-dibromo-N-(2-methoxyethyl)-N-methylpyrazin-2-amine;hydride
sodium;3,5-dibromo-N-(2-methoxyethyl)-N-methylpyrazin-2-amine;hydride (PubChem CID 87940756) has the molecular formula C8H12Br2N3NaO
and a molecular weight of 349.00 g/mol. Its IUPAC name is sodium;3,5-dibromo-N-(2-methoxyethyl)-N-methylpyrazin-2-amine;hydride.
Molecular Properties
| Compound Name | sodium;3,5-dibromo-N-(2-methoxyethyl)-N-methylpyrazin-2-amine;hydride |
| PubChem CID | 87940756 |
| Molecular Formula | C8H12Br2N3NaO |
| Molecular Weight | 349.00 g/mol |
| Exact Mass | 346.92 |
| IUPAC Name | sodium;3,5-dibromo-N-(2-methoxyethyl)-N-methylpyrazin-2-amine;hydride |
| SMILES | COCCN(C)c1ncc(Br)nc1Br.[H-].[Na+] |
| InChI | InChI=1S/C8H11Br2N3O.Na.H/c1-13(3-4-14-2)8-7(10)12-6(9)5-11-8;;/h5H,3-4H2,1-2H3;;/q;+1;-1 |
| InChIKey | DMJBMORAQVNINJ-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.00 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze sodium;3,5-dibromo-N-(2-methoxyethyl)-N-methylpyrazin-2-amine;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;3,5-dibromo-N-(2-methoxyethyl)-N-methylpyrazin-2-amine;hydride?
The IUPAC name of sodium;3,5-dibromo-N-(2-methoxyethyl)-N-methylpyrazin-2-amine;hydride (CID 87940756) is sodium;3,5-dibromo-N-(2-methoxyethyl)-N-methylpyrazin-2-amine;hydride.
What is the SMILES notation for sodium;3,5-dibromo-N-(2-methoxyethyl)-N-methylpyrazin-2-amine;hydride?
The canonical SMILES for sodium;3,5-dibromo-N-(2-methoxyethyl)-N-methylpyrazin-2-amine;hydride is COCCN(C)c1ncc(Br)nc1Br.[H-].[Na+].
What is the InChIKey of sodium;3,5-dibromo-N-(2-methoxyethyl)-N-methylpyrazin-2-amine;hydride?
The InChIKey is DMJBMORAQVNINJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11Br2N3O.Na.H/c1-13(3-4-14-2)8-7(10)12-6(9)5-11-8;;/h5H,3-4H2,1-2H3;;/q;+1;-1.
What are the key properties of sodium;3,5-dibromo-N-(2-methoxyethyl)-N-methylpyrazin-2-amine;hydride?
sodium;3,5-dibromo-N-(2-methoxyethyl)-N-methylpyrazin-2-amine;hydride has a molecular weight of 349.00 g/mol, XLogP of -0.80, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;3,5-dibromo-N-(2-methoxyethyl)-N-methylpyrazin-2-amine;hydride is sourced from PubChem (CID 87940756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).