C20H14F5N3O — CID 87940883
N-[2-[(2,3-difluorophenyl)methylamino]-3-pyridinyl]-N-[3-(trifluoromethyl)phenyl]formamide (PubChem CID 87940883) has the molecular formula C20H14F5N3O and a molecular weight of 407.34 g/mol. Its IUPAC name is N-[2-[(2,3-difluorophenyl)methylamino]-3-pyridinyl]-N-[3-(trifluoromethyl)phenyl]formamide.
| Compound Name | N-[2-[(2,3-difluorophenyl)methylamino]-3-pyridinyl]-N-[3-(trifluoromethyl)phenyl]formamide |
|---|---|
| PubChem CID | 87940883 |
| Molecular Formula | C20H14F5N3O |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | N-[2-[(2,3-difluorophenyl)methylamino]-3-pyridinyl]-N-[3-(trifluoromethyl)phenyl]formamide |
| SMILES | O=CN(c1cccc(C(F)(F)F)c1)c1cccnc1NCc1cccc(F)c1F |
| InChI | InChI=1S/C20H14F5N3O/c21-16-7-1-4-13(18(16)22)11-27-19-17(8-3-9-26-19)28(12-29)15-6-2-5-14(10-15)20(23,24)25/h1-10,12H,11H2,(H,26,27) |
| InChIKey | UGQHFXBMNOURLJ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|