C19H19NO7S — CID 87940951
4-[2-(6-nitro-5-prop-2-enyl-2,3-dihydro-1,4-benzodioxin-3-yl)ethyl]benzenesulfonic acid (PubChem CID 87940951) has the molecular formula C19H19NO7S and a molecular weight of 405.43 g/mol. Its IUPAC name is 4-[2-(6-nitro-5-prop-2-enyl-2,3-dihydro-1,4-benzodioxin-3-yl)ethyl]benzenesulfonic acid.
| Compound Name | 4-[2-(6-nitro-5-prop-2-enyl-2,3-dihydro-1,4-benzodioxin-3-yl)ethyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 87940951 |
| Molecular Formula | C19H19NO7S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 4-[2-(6-nitro-5-prop-2-enyl-2,3-dihydro-1,4-benzodioxin-3-yl)ethyl]benzenesulfonic acid |
| SMILES | C=CCc1c([N+](=O)[O-])ccc2c1OC(CCc1ccc(S(=O)(=O)O)cc1)CO2 |
| InChI | InChI=1S/C19H19NO7S/c1-2-3-16-17(20(21)22)10-11-18-19(16)27-14(12-26-18)7-4-13-5-8-15(9-6-13)28(23,24)25/h2,5-6,8-11,14H,1,3-4,7,12H2,(H,23,24,25) |
| InChIKey | ZJWNADRAGVKTNO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|