C6H4F4N2O2 — CID 87941277
2,3,4,5-tetrafluoro-4-nitrocyclohexa-2,5-dien-1-amine (PubChem CID 87941277) has the molecular formula C6H4F4N2O2 and a molecular weight of 212.10 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-4-nitrocyclohexa-2,5-dien-1-amine.
| Compound Name | 2,3,4,5-tetrafluoro-4-nitrocyclohexa-2,5-dien-1-amine |
|---|---|
| PubChem CID | 87941277 |
| Molecular Formula | C6H4F4N2O2 |
| Molecular Weight | 212.10 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 2,3,4,5-tetrafluoro-4-nitrocyclohexa-2,5-dien-1-amine |
| SMILES | NC1C=C(F)C(F)([N+](=O)[O-])C(F)=C1F |
| InChI | InChI=1S/C6H4F4N2O2/c7-3-1-2(11)4(8)5(9)6(3,10)12(13)14/h1-2H,11H2 |
| InChIKey | OGVUBPQPVRTHEC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.10 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|