C15H13N3O2S — CID 87941436
2-(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl)isoindole-1,3-dione (PubChem CID 87941436) has the molecular formula C15H13N3O2S and a molecular weight of 299.35 g/mol. Its IUPAC name is 2-(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl)isoindole-1,3-dione.
| Compound Name | 2-(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 87941436 |
| Molecular Formula | C15H13N3O2S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 2-(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl)isoindole-1,3-dione |
| SMILES | Nc1nc2c(s1)CCCC2N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H13N3O2S/c16-15-17-12-10(6-3-7-11(12)21-15)18-13(19)8-4-1-2-5-9(8)14(18)20/h1-2,4-5,10H,3,6-7H2,(H2,16,17) |
| InChIKey | GMPVAWPASZGRLV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|