About N-[1-[(3,5-dimethylphenyl)methylamino]cyclopropyl]-1H-benzimidazole-4-carboxamide
N-[1-[(3,5-dimethylphenyl)methylamino]cyclopropyl]-1H-benzimidazole-4-carboxamide (PubChem CID 87941661) has the molecular formula C20H22N4O
and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[1-[(3,5-dimethylphenyl)methylamino]cyclopropyl]-1H-benzimidazole-4-carboxamide.
Molecular Properties
| Compound Name | N-[1-[(3,5-dimethylphenyl)methylamino]cyclopropyl]-1H-benzimidazole-4-carboxamide |
| PubChem CID | 87941661 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | N-[1-[(3,5-dimethylphenyl)methylamino]cyclopropyl]-1H-benzimidazole-4-carboxamide |
| SMILES | Cc1cc(C)cc(CNC2(NC(=O)c3cccc4[nH]cnc34)CC2)c1 |
| InChI | InChI=1S/C20H22N4O/c1-13-8-14(2)10-15(9-13)11-23-20(6-7-20)24-19(25)16-4-3-5-17-18(16)22-12-21-17/h3-5,8-10,12,23H,6-7,11H2,1-2H3,(H,21,22)(H,24,25) |
| InChIKey | NXEKGHSXIVWRDO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[1-[(3,5-dimethylphenyl)methylamino]cyclopropyl]-1H-benzimidazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(3,5-dimethylphenyl)methylamino]cyclopropyl]-1H-benzimidazole-4-carboxamide?
The IUPAC name of N-[1-[(3,5-dimethylphenyl)methylamino]cyclopropyl]-1H-benzimidazole-4-carboxamide (CID 87941661) is N-[1-[(3,5-dimethylphenyl)methylamino]cyclopropyl]-1H-benzimidazole-4-carboxamide.
What is the SMILES notation for N-[1-[(3,5-dimethylphenyl)methylamino]cyclopropyl]-1H-benzimidazole-4-carboxamide?
The canonical SMILES for N-[1-[(3,5-dimethylphenyl)methylamino]cyclopropyl]-1H-benzimidazole-4-carboxamide is Cc1cc(C)cc(CNC2(NC(=O)c3cccc4[nH]cnc34)CC2)c1.
What is the InChIKey of N-[1-[(3,5-dimethylphenyl)methylamino]cyclopropyl]-1H-benzimidazole-4-carboxamide?
The InChIKey is NXEKGHSXIVWRDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4O/c1-13-8-14(2)10-15(9-13)11-23-20(6-7-20)24-19(25)16-4-3-5-17-18(16)22-12-21-17/h3-5,8-10,12,23H,6-7,11H2,1-2H3,(H,21,22)(H,24,25).
What are the key properties of N-[1-[(3,5-dimethylphenyl)methylamino]cyclopropyl]-1H-benzimidazole-4-carboxamide?
N-[1-[(3,5-dimethylphenyl)methylamino]cyclopropyl]-1H-benzimidazole-4-carboxamide has a molecular weight of 334.42 g/mol, XLogP of 3.19, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(3,5-dimethylphenyl)methylamino]cyclopropyl]-1H-benzimidazole-4-carboxamide is sourced from PubChem (CID 87941661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).