C10H16F6N3O5S2+ — CID 87942573
1-(2-ethoxyethyl)-3-methylimidazol-3-ium;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 87942573) has the molecular formula C10H16F6N3O5S2+ and a molecular weight of 436.38 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-3-methylimidazol-3-ium;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide.
| Compound Name | 1-(2-ethoxyethyl)-3-methylimidazol-3-ium;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 87942573 |
| Molecular Formula | C10H16F6N3O5S2+ |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | 1-(2-ethoxyethyl)-3-methylimidazol-3-ium;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | CCOCCn1cc[n+](C)c1.O=S(=O)(NS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H15N2O.C2HF6NO4S2/c1-3-11-7-6-10-5-4-9(2)8-10;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h4-5,8H,3,6-7H2,1-2H3;9H/q+1; |
| InChIKey | OTUJJRFQEKBLLK-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|