C10H7N3O — CID 87943679
3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaene-4-carbaldehyde (PubChem CID 87943679) has the molecular formula C10H7N3O and a molecular weight of 185.19 g/mol. Its IUPAC name is 3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaene-4-carbaldehyde.
| Compound Name | 3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaene-4-carbaldehyde |
|---|---|
| PubChem CID | 87943679 |
| Molecular Formula | C10H7N3O |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaene-4-carbaldehyde |
| SMILES | O=Cc1cn2c(n1)-c1cnccc1C2 |
| InChI | InChI=1S/C10H7N3O/c14-6-8-5-13-4-7-1-2-11-3-9(7)10(13)12-8/h1-3,5-6H,4H2 |
| InChIKey | MULKKEOVQXDKQA-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|