About N-[2-ethoxy-5-(1,3-oxazol-2-yl)phenyl]-4-pyridin-3-yl-1,3-thiazol-2-amine
N-[2-ethoxy-5-(1,3-oxazol-2-yl)phenyl]-4-pyridin-3-yl-1,3-thiazol-2-amine (PubChem CID 87943850) has the molecular formula C19H16N4O2S
and a molecular weight of 364.43 g/mol. Its IUPAC name is N-[2-ethoxy-5-(1,3-oxazol-2-yl)phenyl]-4-pyridin-3-yl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-[2-ethoxy-5-(1,3-oxazol-2-yl)phenyl]-4-pyridin-3-yl-1,3-thiazol-2-amine |
| PubChem CID | 87943850 |
| Molecular Formula | C19H16N4O2S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | N-[2-ethoxy-5-(1,3-oxazol-2-yl)phenyl]-4-pyridin-3-yl-1,3-thiazol-2-amine |
| SMILES | CCOc1ccc(-c2ncco2)cc1Nc1nc(-c2cccnc2)cs1 |
| InChI | InChI=1S/C19H16N4O2S/c1-2-24-17-6-5-13(18-21-8-9-25-18)10-15(17)22-19-23-16(12-26-19)14-4-3-7-20-11-14/h3-12H,2H2,1H3,(H,22,23) |
| InChIKey | IXWQNJQKUFPZMT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[2-ethoxy-5-(1,3-oxazol-2-yl)phenyl]-4-pyridin-3-yl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-ethoxy-5-(1,3-oxazol-2-yl)phenyl]-4-pyridin-3-yl-1,3-thiazol-2-amine?
The IUPAC name of N-[2-ethoxy-5-(1,3-oxazol-2-yl)phenyl]-4-pyridin-3-yl-1,3-thiazol-2-amine (CID 87943850) is N-[2-ethoxy-5-(1,3-oxazol-2-yl)phenyl]-4-pyridin-3-yl-1,3-thiazol-2-amine.
What is the SMILES notation for N-[2-ethoxy-5-(1,3-oxazol-2-yl)phenyl]-4-pyridin-3-yl-1,3-thiazol-2-amine?
The canonical SMILES for N-[2-ethoxy-5-(1,3-oxazol-2-yl)phenyl]-4-pyridin-3-yl-1,3-thiazol-2-amine is CCOc1ccc(-c2ncco2)cc1Nc1nc(-c2cccnc2)cs1.
What is the InChIKey of N-[2-ethoxy-5-(1,3-oxazol-2-yl)phenyl]-4-pyridin-3-yl-1,3-thiazol-2-amine?
The InChIKey is IXWQNJQKUFPZMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4O2S/c1-2-24-17-6-5-13(18-21-8-9-25-18)10-15(17)22-19-23-16(12-26-19)14-4-3-7-20-11-14/h3-12H,2H2,1H3,(H,22,23).
What are the key properties of N-[2-ethoxy-5-(1,3-oxazol-2-yl)phenyl]-4-pyridin-3-yl-1,3-thiazol-2-amine?
N-[2-ethoxy-5-(1,3-oxazol-2-yl)phenyl]-4-pyridin-3-yl-1,3-thiazol-2-amine has a molecular weight of 364.43 g/mol, XLogP of 5.00, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-ethoxy-5-(1,3-oxazol-2-yl)phenyl]-4-pyridin-3-yl-1,3-thiazol-2-amine is sourced from PubChem (CID 87943850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).