About 3-fluoro-4-methoxy-5-[(6-methylimidazo[4,5-e][1,3]benzothiazol-2-yl)amino]benzamide
3-fluoro-4-methoxy-5-[(6-methylimidazo[4,5-e][1,3]benzothiazol-2-yl)amino]benzamide (PubChem CID 87944203) has the molecular formula C17H14FN5O2S
and a molecular weight of 371.40 g/mol. Its IUPAC name is 3-fluoro-4-methoxy-5-[(6-methylimidazo[4,5-e][1,3]benzothiazol-2-yl)amino]benzamide.
Molecular Properties
| Compound Name | 3-fluoro-4-methoxy-5-[(6-methylimidazo[4,5-e][1,3]benzothiazol-2-yl)amino]benzamide |
| PubChem CID | 87944203 |
| Molecular Formula | C17H14FN5O2S |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 3-fluoro-4-methoxy-5-[(6-methylimidazo[4,5-e][1,3]benzothiazol-2-yl)amino]benzamide |
| SMILES | COc1c(F)cc(C(N)=O)cc1Nc1nc2c(ccc3c2ncn3C)s1 |
| InChI | InChI=1S/C17H14FN5O2S/c1-23-7-20-13-11(23)3-4-12-14(13)22-17(26-12)21-10-6-8(16(19)24)5-9(18)15(10)25-2/h3-7H,1-2H3,(H2,19,24)(H,21,22) |
| InChIKey | URFHJUUDWKLWEX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-fluoro-4-methoxy-5-[(6-methylimidazo[4,5-e][1,3]benzothiazol-2-yl)amino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-methoxy-5-[(6-methylimidazo[4,5-e][1,3]benzothiazol-2-yl)amino]benzamide?
The IUPAC name of 3-fluoro-4-methoxy-5-[(6-methylimidazo[4,5-e][1,3]benzothiazol-2-yl)amino]benzamide (CID 87944203) is 3-fluoro-4-methoxy-5-[(6-methylimidazo[4,5-e][1,3]benzothiazol-2-yl)amino]benzamide.
What is the SMILES notation for 3-fluoro-4-methoxy-5-[(6-methylimidazo[4,5-e][1,3]benzothiazol-2-yl)amino]benzamide?
The canonical SMILES for 3-fluoro-4-methoxy-5-[(6-methylimidazo[4,5-e][1,3]benzothiazol-2-yl)amino]benzamide is COc1c(F)cc(C(N)=O)cc1Nc1nc2c(ccc3c2ncn3C)s1.
What is the InChIKey of 3-fluoro-4-methoxy-5-[(6-methylimidazo[4,5-e][1,3]benzothiazol-2-yl)amino]benzamide?
The InChIKey is URFHJUUDWKLWEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14FN5O2S/c1-23-7-20-13-11(23)3-4-12-14(13)22-17(26-12)21-10-6-8(16(19)24)5-9(18)15(10)25-2/h3-7H,1-2H3,(H2,19,24)(H,21,22).
What are the key properties of 3-fluoro-4-methoxy-5-[(6-methylimidazo[4,5-e][1,3]benzothiazol-2-yl)amino]benzamide?
3-fluoro-4-methoxy-5-[(6-methylimidazo[4,5-e][1,3]benzothiazol-2-yl)amino]benzamide has a molecular weight of 371.40 g/mol, XLogP of 3.17, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-methoxy-5-[(6-methylimidazo[4,5-e][1,3]benzothiazol-2-yl)amino]benzamide is sourced from PubChem (CID 87944203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).