About 2-(6-chloro-5-fluoro-2-pyridinyl)-3,1-benzoxazin-4-one
2-(6-chloro-5-fluoro-2-pyridinyl)-3,1-benzoxazin-4-one (PubChem CID 87944829) has the molecular formula C13H6ClFN2O2
and a molecular weight of 276.65 g/mol. Its IUPAC name is 2-(6-chloro-5-fluoro-2-pyridinyl)-3,1-benzoxazin-4-one.
Molecular Properties
| Compound Name | 2-(6-chloro-5-fluoro-2-pyridinyl)-3,1-benzoxazin-4-one |
| PubChem CID | 87944829 |
| Molecular Formula | C13H6ClFN2O2 |
| Molecular Weight | 276.65 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 2-(6-chloro-5-fluoro-2-pyridinyl)-3,1-benzoxazin-4-one |
| SMILES | O=c1oc(-c2ccc(F)c(Cl)n2)nc2ccccc12 |
| InChI | InChI=1S/C13H6ClFN2O2/c14-11-8(15)5-6-10(16-11)12-17-9-4-2-1-3-7(9)13(18)19-12/h1-6H |
| InChIKey | VCNQSWPUGHOFBM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.65 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-chloro-5-fluoro-2-pyridinyl)-3,1-benzoxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-chloro-5-fluoro-2-pyridinyl)-3,1-benzoxazin-4-one?
The IUPAC name of 2-(6-chloro-5-fluoro-2-pyridinyl)-3,1-benzoxazin-4-one (CID 87944829) is 2-(6-chloro-5-fluoro-2-pyridinyl)-3,1-benzoxazin-4-one.
What is the SMILES notation for 2-(6-chloro-5-fluoro-2-pyridinyl)-3,1-benzoxazin-4-one?
The canonical SMILES for 2-(6-chloro-5-fluoro-2-pyridinyl)-3,1-benzoxazin-4-one is O=c1oc(-c2ccc(F)c(Cl)n2)nc2ccccc12.
What is the InChIKey of 2-(6-chloro-5-fluoro-2-pyridinyl)-3,1-benzoxazin-4-one?
The InChIKey is VCNQSWPUGHOFBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6ClFN2O2/c14-11-8(15)5-6-10(16-11)12-17-9-4-2-1-3-7(9)13(18)19-12/h1-6H.
What are the key properties of 2-(6-chloro-5-fluoro-2-pyridinyl)-3,1-benzoxazin-4-one?
2-(6-chloro-5-fluoro-2-pyridinyl)-3,1-benzoxazin-4-one has a molecular weight of 276.65 g/mol, XLogP of 3.04, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chloro-5-fluoro-2-pyridinyl)-3,1-benzoxazin-4-one is sourced from PubChem (CID 87944829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).