C9H8F6N4O3 — CID 87944927
[6-oxo-2-(trifluoromethyl)-1H-pyrimidin-4-yl] acetate;2,2,2-trifluoroethanimidamide (PubChem CID 87944927) has the molecular formula C9H8F6N4O3 and a molecular weight of 334.18 g/mol. Its IUPAC name is [6-oxo-2-(trifluoromethyl)-1H-pyrimidin-4-yl] acetate;2,2,2-trifluoroethanimidamide.
| Compound Name | [6-oxo-2-(trifluoromethyl)-1H-pyrimidin-4-yl] acetate;2,2,2-trifluoroethanimidamide |
|---|---|
| PubChem CID | 87944927 |
| Molecular Formula | C9H8F6N4O3 |
| Molecular Weight | 334.18 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | [6-oxo-2-(trifluoromethyl)-1H-pyrimidin-4-yl] acetate;2,2,2-trifluoroethanimidamide |
| SMILES | CC(=O)Oc1cc(=O)[nH]c(C(F)(F)F)n1.[H]/N=C(\N)C(F)(F)F |
| InChI | InChI=1S/C7H5F3N2O3.C2H3F3N2/c1-3(13)15-5-2-4(14)11-6(12-5)7(8,9)10;3-2(4,5)1(6)7/h2H,1H3,(H,11,12,14);(H3,6,7) |
| InChIKey | KLCPSMFBQXSFNM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 121.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.18 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|