C23H26ClN3O4S — CID 87945075
[2-amino-5-[[4-(chloromethyl)-2-methoxyphenyl]methyl]-6-methylpyrimidin-4-yl] 2,4,6-trimethylbenzenesulfonate (PubChem CID 87945075) has the molecular formula C23H26ClN3O4S and a molecular weight of 476.00 g/mol. Its IUPAC name is [2-amino-5-[[4-(chloromethyl)-2-methoxyphenyl]methyl]-6-methylpyrimidin-4-yl] 2,4,6-trimethylbenzenesulfonate.
| Compound Name | [2-amino-5-[[4-(chloromethyl)-2-methoxyphenyl]methyl]-6-methylpyrimidin-4-yl] 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 87945075 |
| Molecular Formula | C23H26ClN3O4S |
| Molecular Weight | 476.00 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | [2-amino-5-[[4-(chloromethyl)-2-methoxyphenyl]methyl]-6-methylpyrimidin-4-yl] 2,4,6-trimethylbenzenesulfonate |
| SMILES | COc1cc(CCl)ccc1Cc1c(C)nc(N)nc1OS(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C23H26ClN3O4S/c1-13-8-14(2)21(15(3)9-13)32(28,29)31-22-19(16(4)26-23(25)27-22)11-18-7-6-17(12-24)10-20(18)30-5/h6-10H,11-12H2,1-5H3,(H2,25,26,27) |
| InChIKey | OPBNAEHFJMRLHU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.00 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|