C12H23NO3 — CID 87945455
N-[(E,2S,3R)-1,3-dihydroxyhept-4-en-2-yl]pentanamide (PubChem CID 87945455) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is N-[(E,2S,3R)-1,3-dihydroxyhept-4-en-2-yl]pentanamide.
| Compound Name | N-[(E,2S,3R)-1,3-dihydroxyhept-4-en-2-yl]pentanamide |
|---|---|
| PubChem CID | 87945455 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | N-[(E,2S,3R)-1,3-dihydroxyhept-4-en-2-yl]pentanamide |
| SMILES | CC/C=C/[C@@H](O)[C@H](CO)NC(=O)CCCC |
| InChI | InChI=1S/C12H23NO3/c1-3-5-7-11(15)10(9-14)13-12(16)8-6-4-2/h5,7,10-11,14-15H,3-4,6,8-9H2,1-2H3,(H,13,16)/b7-5+/t10-,11+/m0/s1 |
| InChIKey | GELBVPCLQCVURT-KKSDUGGKSA-N |
| XLogP | 0.98 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|