C24H26BrN3O3 — CID 87945650
[3-(aminomethyl)phenyl]methyl (1R,2R,3R,4S)-3-[(6-bromo-3-pyridinyl)carbamoyl]spiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2-carboxylate (PubChem CID 87945650) has the molecular formula C24H26BrN3O3 and a molecular weight of 484.39 g/mol. Its IUPAC name is [3-(aminomethyl)phenyl]methyl (1R,2R,3R,4S)-3-[(6-bromo-3-pyridinyl)carbamoyl]spiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2-carboxylate.
| Compound Name | [3-(aminomethyl)phenyl]methyl (1R,2R,3R,4S)-3-[(6-bromo-3-pyridinyl)carbamoyl]spiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2-carboxylate |
|---|---|
| PubChem CID | 87945650 |
| Molecular Formula | C24H26BrN3O3 |
| Molecular Weight | 484.39 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | [3-(aminomethyl)phenyl]methyl (1R,2R,3R,4S)-3-[(6-bromo-3-pyridinyl)carbamoyl]spiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2-carboxylate |
| SMILES | NCc1cccc(COC(=O)[C@H]2[C@H](C(=O)Nc3ccc(Br)nc3)[C@@H]3CC[C@H]2C32CC2)c1 |
| InChI | InChI=1S/C24H26BrN3O3/c25-19-7-4-16(12-27-19)28-22(29)20-17-5-6-18(24(17)8-9-24)21(20)23(30)31-13-15-3-1-2-14(10-15)11-26/h1-4,7,10,12,17-18,20-21H,5-6,8-9,11,13,26H2,(H,28,29)/t17-,18+,20+,21+/m0/s1 |
| InChIKey | DWISHNYKQDJLLI-UYWIDEMCSA-N |
| XLogP | 4.04 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|