About N-[(2S)-butan-2-yl]-1-cyclohexa-2,4-dien-1-ylethanimine
N-[(2S)-butan-2-yl]-1-cyclohexa-2,4-dien-1-ylethanimine (PubChem CID 87945903) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-1-cyclohexa-2,4-dien-1-ylethanimine.
Molecular Properties
| Compound Name | N-[(2S)-butan-2-yl]-1-cyclohexa-2,4-dien-1-ylethanimine |
| PubChem CID | 87945903 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | N-[(2S)-butan-2-yl]-1-cyclohexa-2,4-dien-1-ylethanimine |
| SMILES | CC[C@H](C)/N=C(\C)C1C=CC=CC1 |
| InChI | InChI=1S/C12H19N/c1-4-10(2)13-11(3)12-8-6-5-7-9-12/h5-8,10,12H,4,9H2,1-3H3/b13-11+/t10-,12?/m0/s1 |
| InChIKey | KUQLUTKMFLEFIS-OSIMGRJOSA-N |
| XLogP | 3.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(2S)-butan-2-yl]-1-cyclohexa-2,4-dien-1-ylethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-butan-2-yl]-1-cyclohexa-2,4-dien-1-ylethanimine?
The IUPAC name of N-[(2S)-butan-2-yl]-1-cyclohexa-2,4-dien-1-ylethanimine (CID 87945903) is N-[(2S)-butan-2-yl]-1-cyclohexa-2,4-dien-1-ylethanimine.
What is the SMILES notation for N-[(2S)-butan-2-yl]-1-cyclohexa-2,4-dien-1-ylethanimine?
The canonical SMILES for N-[(2S)-butan-2-yl]-1-cyclohexa-2,4-dien-1-ylethanimine is CC[C@H](C)/N=C(\C)C1C=CC=CC1.
What is the InChIKey of N-[(2S)-butan-2-yl]-1-cyclohexa-2,4-dien-1-ylethanimine?
The InChIKey is KUQLUTKMFLEFIS-OSIMGRJOSA-N. The full InChI is InChI=1S/C12H19N/c1-4-10(2)13-11(3)12-8-6-5-7-9-12/h5-8,10,12H,4,9H2,1-3H3/b13-11+/t10-,12?/m0/s1.
What are the key properties of N-[(2S)-butan-2-yl]-1-cyclohexa-2,4-dien-1-ylethanimine?
N-[(2S)-butan-2-yl]-1-cyclohexa-2,4-dien-1-ylethanimine has a molecular weight of 177.29 g/mol, XLogP of 3.38, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-butan-2-yl]-1-cyclohexa-2,4-dien-1-ylethanimine is sourced from PubChem (CID 87945903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).