About 3-methyl-1,5-dinitroso-1,3,5-triazocane
3-methyl-1,5-dinitroso-1,3,5-triazocane (PubChem CID 87945985) has the molecular formula C6H13N5O2
and a molecular weight of 187.20 g/mol. Its IUPAC name is 3-methyl-1,5-dinitroso-1,3,5-triazocane.
Molecular Properties
| Compound Name | 3-methyl-1,5-dinitroso-1,3,5-triazocane |
| PubChem CID | 87945985 |
| Molecular Formula | C6H13N5O2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 3-methyl-1,5-dinitroso-1,3,5-triazocane |
| SMILES | CN1CN(N=O)CCCN(N=O)C1 |
| InChI | InChI=1S/C6H13N5O2/c1-9-5-10(7-12)3-2-4-11(6-9)8-13/h2-6H2,1H3 |
| InChIKey | RMDQLUQSXXPDTE-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 68.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1,5-dinitroso-1,3,5-triazocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,5-dinitroso-1,3,5-triazocane?
The IUPAC name of 3-methyl-1,5-dinitroso-1,3,5-triazocane (CID 87945985) is 3-methyl-1,5-dinitroso-1,3,5-triazocane.
What is the SMILES notation for 3-methyl-1,5-dinitroso-1,3,5-triazocane?
The canonical SMILES for 3-methyl-1,5-dinitroso-1,3,5-triazocane is CN1CN(N=O)CCCN(N=O)C1.
What is the InChIKey of 3-methyl-1,5-dinitroso-1,3,5-triazocane?
The InChIKey is RMDQLUQSXXPDTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N5O2/c1-9-5-10(7-12)3-2-4-11(6-9)8-13/h2-6H2,1H3.
What are the key properties of 3-methyl-1,5-dinitroso-1,3,5-triazocane?
3-methyl-1,5-dinitroso-1,3,5-triazocane has a molecular weight of 187.20 g/mol, XLogP of 0.20, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,5-dinitroso-1,3,5-triazocane is sourced from PubChem (CID 87945985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).