C8H13F5O6S — CID 87946454
1,2-diethoxy-1-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonic acid (PubChem CID 87946454) has the molecular formula C8H13F5O6S and a molecular weight of 332.24 g/mol. Its IUPAC name is 1,2-diethoxy-1-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonic acid.
| Compound Name | 1,2-diethoxy-1-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonic acid |
|---|---|
| PubChem CID | 87946454 |
| Molecular Formula | C8H13F5O6S |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 1,2-diethoxy-1-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonic acid |
| SMILES | CCOCC(OCC)(OC(F)(F)C(F)(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C8H13F5O6S/c1-3-17-5-6(18-4-2,20(14,15)16)19-8(12,13)7(9,10)11/h3-5H2,1-2H3,(H,14,15,16) |
| InChIKey | MLELTMBMVITEBQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|