About [3-(1-amino-1-oxopropan-2-yl)-6-fluoro-2,3-dihydro-1H-inden-1-yl] methanesulfonate;propane
[3-(1-amino-1-oxopropan-2-yl)-6-fluoro-2,3-dihydro-1H-inden-1-yl] methanesulfonate;propane (PubChem CID 87946706) has the molecular formula C16H24FNO4S
and a molecular weight of 345.44 g/mol. Its IUPAC name is [3-(1-amino-1-oxopropan-2-yl)-6-fluoro-2,3-dihydro-1H-inden-1-yl] methanesulfonate;propane.
Molecular Properties
| Compound Name | [3-(1-amino-1-oxopropan-2-yl)-6-fluoro-2,3-dihydro-1H-inden-1-yl] methanesulfonate;propane |
| PubChem CID | 87946706 |
| Molecular Formula | C16H24FNO4S |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | [3-(1-amino-1-oxopropan-2-yl)-6-fluoro-2,3-dihydro-1H-inden-1-yl] methanesulfonate;propane |
| SMILES | CC(C(N)=O)C1CC(OS(C)(=O)=O)c2cc(F)ccc21.CCC |
| InChI | InChI=1S/C13H16FNO4S.C3H8/c1-7(13(15)16)10-6-12(19-20(2,17)18)11-5-8(14)3-4-9(10)11;1-3-2/h3-5,7,10,12H,6H2,1-2H3,(H2,15,16);3H2,1-2H3 |
| InChIKey | BSUNAIWKIFPPSM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(1-amino-1-oxopropan-2-yl)-6-fluoro-2,3-dihydro-1H-inden-1-yl] methanesulfonate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1-amino-1-oxopropan-2-yl)-6-fluoro-2,3-dihydro-1H-inden-1-yl] methanesulfonate;propane?
The IUPAC name of [3-(1-amino-1-oxopropan-2-yl)-6-fluoro-2,3-dihydro-1H-inden-1-yl] methanesulfonate;propane (CID 87946706) is [3-(1-amino-1-oxopropan-2-yl)-6-fluoro-2,3-dihydro-1H-inden-1-yl] methanesulfonate;propane.
What is the SMILES notation for [3-(1-amino-1-oxopropan-2-yl)-6-fluoro-2,3-dihydro-1H-inden-1-yl] methanesulfonate;propane?
The canonical SMILES for [3-(1-amino-1-oxopropan-2-yl)-6-fluoro-2,3-dihydro-1H-inden-1-yl] methanesulfonate;propane is CC(C(N)=O)C1CC(OS(C)(=O)=O)c2cc(F)ccc21.CCC.
What is the InChIKey of [3-(1-amino-1-oxopropan-2-yl)-6-fluoro-2,3-dihydro-1H-inden-1-yl] methanesulfonate;propane?
The InChIKey is BSUNAIWKIFPPSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16FNO4S.C3H8/c1-7(13(15)16)10-6-12(19-20(2,17)18)11-5-8(14)3-4-9(10)11;1-3-2/h3-5,7,10,12H,6H2,1-2H3,(H2,15,16);3H2,1-2H3.
What are the key properties of [3-(1-amino-1-oxopropan-2-yl)-6-fluoro-2,3-dihydro-1H-inden-1-yl] methanesulfonate;propane?
[3-(1-amino-1-oxopropan-2-yl)-6-fluoro-2,3-dihydro-1H-inden-1-yl] methanesulfonate;propane has a molecular weight of 345.44 g/mol, XLogP of 2.87, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1-amino-1-oxopropan-2-yl)-6-fluoro-2,3-dihydro-1H-inden-1-yl] methanesulfonate;propane is sourced from PubChem (CID 87946706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).