C6H6F6O — CID 87946709
3,3,4,4,5,5-hexafluoro-2-methylidenepentan-1-ol (PubChem CID 87946709) has the molecular formula C6H6F6O and a molecular weight of 208.10 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-2-methylidenepentan-1-ol.
| Compound Name | 3,3,4,4,5,5-hexafluoro-2-methylidenepentan-1-ol |
|---|---|
| PubChem CID | 87946709 |
| Molecular Formula | C6H6F6O |
| Molecular Weight | 208.10 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-2-methylidenepentan-1-ol |
| SMILES | C=C(CO)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C6H6F6O/c1-3(2-13)5(9,10)6(11,12)4(7)8/h4,13H,1-2H2 |
| InChIKey | IUKSVNLFZKUJSI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.10 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|