About ethyl 3-ethoxypropanoate;2-methoxyethyl acetate;prop-1-ene
ethyl 3-ethoxypropanoate;2-methoxyethyl acetate;prop-1-ene (PubChem CID 87946884) has the molecular formula C15H30O6
and a molecular weight of 306.40 g/mol. Its IUPAC name is ethyl 3-ethoxypropanoate;2-methoxyethyl acetate;prop-1-ene.
Molecular Properties
| Compound Name | ethyl 3-ethoxypropanoate;2-methoxyethyl acetate;prop-1-ene |
| PubChem CID | 87946884 |
| Molecular Formula | C15H30O6 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | ethyl 3-ethoxypropanoate;2-methoxyethyl acetate;prop-1-ene |
| SMILES | C=CC.CCOCCC(=O)OCC.COCCOC(C)=O |
| InChI | InChI=1S/C7H14O3.C5H10O3.C3H6/c1-3-9-6-5-7(8)10-4-2;1-5(6)8-4-3-7-2;1-3-2/h3-6H2,1-2H3;3-4H2,1-2H3;3H,1H2,2H3 |
| InChIKey | PGPSKYZANDZYLE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-ethoxypropanoate;2-methoxyethyl acetate;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-ethoxypropanoate;2-methoxyethyl acetate;prop-1-ene?
The IUPAC name of ethyl 3-ethoxypropanoate;2-methoxyethyl acetate;prop-1-ene (CID 87946884) is ethyl 3-ethoxypropanoate;2-methoxyethyl acetate;prop-1-ene.
What is the SMILES notation for ethyl 3-ethoxypropanoate;2-methoxyethyl acetate;prop-1-ene?
The canonical SMILES for ethyl 3-ethoxypropanoate;2-methoxyethyl acetate;prop-1-ene is C=CC.CCOCCC(=O)OCC.COCCOC(C)=O.
What is the InChIKey of ethyl 3-ethoxypropanoate;2-methoxyethyl acetate;prop-1-ene?
The InChIKey is PGPSKYZANDZYLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O3.C5H10O3.C3H6/c1-3-9-6-5-7(8)10-4-2;1-5(6)8-4-3-7-2;1-3-2/h3-6H2,1-2H3;3-4H2,1-2H3;3H,1H2,2H3.
What are the key properties of ethyl 3-ethoxypropanoate;2-methoxyethyl acetate;prop-1-ene?
ethyl 3-ethoxypropanoate;2-methoxyethyl acetate;prop-1-ene has a molecular weight of 306.40 g/mol, XLogP of 2.36, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-ethoxypropanoate;2-methoxyethyl acetate;prop-1-ene is sourced from PubChem (CID 87946884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).