C22H26ClNO4 — CID 87947050
6,7-dimethoxy-2-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-3,4-dihydro-1H-isoquinoline;hydrochloride (PubChem CID 87947050) has the molecular formula C22H26ClNO4 and a molecular weight of 403.91 g/mol. Its IUPAC name is 6,7-dimethoxy-2-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-3,4-dihydro-1H-isoquinoline;hydrochloride.
| Compound Name | 6,7-dimethoxy-2-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-3,4-dihydro-1H-isoquinoline;hydrochloride |
|---|---|
| PubChem CID | 87947050 |
| Molecular Formula | C22H26ClNO4 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 6,7-dimethoxy-2-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-3,4-dihydro-1H-isoquinoline;hydrochloride |
| SMILES | C#CCOc1cc(CN2CCc3cc(OC)c(OC)cc3C2)ccc1OC.Cl |
| InChI | InChI=1S/C22H25NO4.ClH/c1-5-10-27-22-11-16(6-7-19(22)24-2)14-23-9-8-17-12-20(25-3)21(26-4)13-18(17)15-23;/h1,6-7,11-13H,8-10,14-15H2,2-4H3;1H |
| InChIKey | RKUSTOHOAMSNJO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|