About pyrazine-1,4-dicarbonitrile
pyrazine-1,4-dicarbonitrile (PubChem CID 87947804) has the molecular formula C6H4N4
and a molecular weight of 132.13 g/mol. Its IUPAC name is pyrazine-1,4-dicarbonitrile.
Molecular Properties
| Compound Name | pyrazine-1,4-dicarbonitrile |
| PubChem CID | 87947804 |
| Molecular Formula | C6H4N4 |
| Molecular Weight | 132.13 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | pyrazine-1,4-dicarbonitrile |
| SMILES | N#CN1C=CN(C#N)C=C1 |
| InChI | InChI=1S/C6H4N4/c7-5-9-1-2-10(6-8)4-3-9/h1-4H |
| InChIKey | NKYGXIXPKDNEHE-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.13 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze pyrazine-1,4-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazine-1,4-dicarbonitrile?
The IUPAC name of pyrazine-1,4-dicarbonitrile (CID 87947804) is pyrazine-1,4-dicarbonitrile.
What is the SMILES notation for pyrazine-1,4-dicarbonitrile?
The canonical SMILES for pyrazine-1,4-dicarbonitrile is N#CN1C=CN(C#N)C=C1.
What is the InChIKey of pyrazine-1,4-dicarbonitrile?
The InChIKey is NKYGXIXPKDNEHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4/c7-5-9-1-2-10(6-8)4-3-9/h1-4H.
What are the key properties of pyrazine-1,4-dicarbonitrile?
pyrazine-1,4-dicarbonitrile has a molecular weight of 132.13 g/mol, XLogP of 0.51, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazine-1,4-dicarbonitrile is sourced from PubChem (CID 87947804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).