About (2S)-2-amino-4-methylpentan-1-ol;sulfamide
(2S)-2-amino-4-methylpentan-1-ol;sulfamide (PubChem CID 87947819) has the molecular formula C6H19N3O3S
and a molecular weight of 213.30 g/mol. Its IUPAC name is (2S)-2-amino-4-methylpentan-1-ol;sulfamide.
Molecular Properties
| Compound Name | (2S)-2-amino-4-methylpentan-1-ol;sulfamide |
| PubChem CID | 87947819 |
| Molecular Formula | C6H19N3O3S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | (2S)-2-amino-4-methylpentan-1-ol;sulfamide |
| SMILES | CC(C)C[C@H](N)CO.NS(N)(=O)=O |
| InChI | InChI=1S/C6H15NO.H4N2O2S/c1-5(2)3-6(7)4-8;1-5(2,3)4/h5-6,8H,3-4,7H2,1-2H3;(H4,1,2,3,4)/t6-;/m0./s1 |
| InChIKey | PRGYZCXJZROXEZ-RGMNGODLSA-N |
| XLogP | -1.50 |
| TPSA | 132.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-amino-4-methylpentan-1-ol;sulfamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-4-methylpentan-1-ol;sulfamide?
The IUPAC name of (2S)-2-amino-4-methylpentan-1-ol;sulfamide (CID 87947819) is (2S)-2-amino-4-methylpentan-1-ol;sulfamide.
What is the SMILES notation for (2S)-2-amino-4-methylpentan-1-ol;sulfamide?
The canonical SMILES for (2S)-2-amino-4-methylpentan-1-ol;sulfamide is CC(C)C[C@H](N)CO.NS(N)(=O)=O.
What is the InChIKey of (2S)-2-amino-4-methylpentan-1-ol;sulfamide?
The InChIKey is PRGYZCXJZROXEZ-RGMNGODLSA-N. The full InChI is InChI=1S/C6H15NO.H4N2O2S/c1-5(2)3-6(7)4-8;1-5(2,3)4/h5-6,8H,3-4,7H2,1-2H3;(H4,1,2,3,4)/t6-;/m0./s1.
What are the key properties of (2S)-2-amino-4-methylpentan-1-ol;sulfamide?
(2S)-2-amino-4-methylpentan-1-ol;sulfamide has a molecular weight of 213.30 g/mol, XLogP of -1.50, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-4-methylpentan-1-ol;sulfamide is sourced from PubChem (CID 87947819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).