C12H14F6 — CID 87947834
7,8-bis(trifluoromethyl)-1,2,3,4,4a,5,6,8a-octahydronaphthalene (PubChem CID 87947834) has the molecular formula C12H14F6 and a molecular weight of 272.23 g/mol. Its IUPAC name is 7,8-bis(trifluoromethyl)-1,2,3,4,4a,5,6,8a-octahydronaphthalene.
| Compound Name | 7,8-bis(trifluoromethyl)-1,2,3,4,4a,5,6,8a-octahydronaphthalene |
|---|---|
| PubChem CID | 87947834 |
| Molecular Formula | C12H14F6 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 7,8-bis(trifluoromethyl)-1,2,3,4,4a,5,6,8a-octahydronaphthalene |
| SMILES | FC(F)(F)C1=C(C(F)(F)F)C2CCCCC2CC1 |
| InChI | InChI=1S/C12H14F6/c13-11(14,15)9-6-5-7-3-1-2-4-8(7)10(9)12(16,17)18/h7-8H,1-6H2 |
| InChIKey | RKMGKPUNYHKOCJ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|