About perchloric acid;2,2,2-trifluoroacetic acid
perchloric acid;2,2,2-trifluoroacetic acid (PubChem CID 87947890) has the molecular formula C2H2ClF3O6
and a molecular weight of 214.48 g/mol. Its IUPAC name is perchloric acid;2,2,2-trifluoroacetic acid.
Molecular Properties
| Compound Name | perchloric acid;2,2,2-trifluoroacetic acid |
| PubChem CID | 87947890 |
| Molecular Formula | C2H2ClF3O6 |
| Molecular Weight | 214.48 g/mol |
| Exact Mass | 213.95 |
| IUPAC Name | perchloric acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C2HF3O2.ClHO4/c3-2(4,5)1(6)7;2-1(3,4)5/h(H,6,7);(H,2,3,4,5) |
| InChIKey | FLBOODOVGOOIKB-UHFFFAOYSA-N |
| XLogP | -3.49 |
| TPSA | 126.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.48 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze perchloric acid;2,2,2-trifluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of perchloric acid;2,2,2-trifluoroacetic acid?
The IUPAC name of perchloric acid;2,2,2-trifluoroacetic acid (CID 87947890) is perchloric acid;2,2,2-trifluoroacetic acid.
What is the SMILES notation for perchloric acid;2,2,2-trifluoroacetic acid?
The canonical SMILES for perchloric acid;2,2,2-trifluoroacetic acid is O=C(O)C(F)(F)F.[O-][Cl+3]([O-])([O-])O.
What is the InChIKey of perchloric acid;2,2,2-trifluoroacetic acid?
The InChIKey is FLBOODOVGOOIKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C2HF3O2.ClHO4/c3-2(4,5)1(6)7;2-1(3,4)5/h(H,6,7);(H,2,3,4,5).
What are the key properties of perchloric acid;2,2,2-trifluoroacetic acid?
perchloric acid;2,2,2-trifluoroacetic acid has a molecular weight of 214.48 g/mol, XLogP of -3.49, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for perchloric acid;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 87947890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).