perchloric acid;2,2,2-trifluoroacetic acid

C2H2ClF3O6 — CID 87947890

IUPACperchloric acid;2,2,2-trifluoroacetic acid
SMILESO=C(O)C(F)(F)F.[O-][Cl+3]([O-])([O-])O
InChIInChI=1S/C2HF3O2.ClHO4/c3-2(4,5)1(6)7;2-1(3,4)5/h(H,6,7);(H,2,3,4,5)
InChIKeyFLBOODOVGOOIKB-UHFFFAOYSA-N
MW214.48 g/mol
LogP-3.49
Rot. Bonds

About perchloric acid;2,2,2-trifluoroacetic acid

perchloric acid;2,2,2-trifluoroacetic acid (PubChem CID 87947890) has the molecular formula C2H2ClF3O6 and a molecular weight of 214.48 g/mol. Its IUPAC name is perchloric acid;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Nameperchloric acid;2,2,2-trifluoroacetic acid
PubChem CID87947890
Molecular FormulaC2H2ClF3O6
Molecular Weight214.48 g/mol
Exact Mass213.95
IUPAC Nameperchloric acid;2,2,2-trifluoroacetic acid
SMILESO=C(O)C(F)(F)F.[O-][Cl+3]([O-])([O-])O
InChIInChI=1S/C2HF3O2.ClHO4/c3-2(4,5)1(6)7;2-1(3,4)5/h(H,6,7);(H,2,3,4,5)
InChIKeyFLBOODOVGOOIKB-UHFFFAOYSA-N
XLogP-3.49
TPSA126.71 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.48
LogP ≤ 5-3.49
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze perchloric acid;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of perchloric acid;2,2,2-trifluoroacetic acid?
The IUPAC name of perchloric acid;2,2,2-trifluoroacetic acid (CID 87947890) is perchloric acid;2,2,2-trifluoroacetic acid.
What is the SMILES notation for perchloric acid;2,2,2-trifluoroacetic acid?
The canonical SMILES for perchloric acid;2,2,2-trifluoroacetic acid is O=C(O)C(F)(F)F.[O-][Cl+3]([O-])([O-])O.
What is the InChIKey of perchloric acid;2,2,2-trifluoroacetic acid?
The InChIKey is FLBOODOVGOOIKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C2HF3O2.ClHO4/c3-2(4,5)1(6)7;2-1(3,4)5/h(H,6,7);(H,2,3,4,5).
What are the key properties of perchloric acid;2,2,2-trifluoroacetic acid?
perchloric acid;2,2,2-trifluoroacetic acid has a molecular weight of 214.48 g/mol, XLogP of -3.49, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for perchloric acid;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 87947890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).