About 1-chloro-4-[3-(dibutylamino)propoxy]cyclohexa-2,4-diene-1-carbonyl chloride
1-chloro-4-[3-(dibutylamino)propoxy]cyclohexa-2,4-diene-1-carbonyl chloride (PubChem CID 87948387) has the molecular formula C18H29Cl2NO2
and a molecular weight of 362.34 g/mol. Its IUPAC name is 1-chloro-4-[3-(dibutylamino)propoxy]cyclohexa-2,4-diene-1-carbonyl chloride.
Molecular Properties
| Compound Name | 1-chloro-4-[3-(dibutylamino)propoxy]cyclohexa-2,4-diene-1-carbonyl chloride |
| PubChem CID | 87948387 |
| Molecular Formula | C18H29Cl2NO2 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 1-chloro-4-[3-(dibutylamino)propoxy]cyclohexa-2,4-diene-1-carbonyl chloride |
| SMILES | CCCCN(CCCC)CCCOC1=CCC(Cl)(C(=O)Cl)C=C1 |
| InChI | InChI=1S/C18H29Cl2NO2/c1-3-5-12-21(13-6-4-2)14-7-15-23-16-8-10-18(20,11-9-16)17(19)22/h8-10H,3-7,11-15H2,1-2H3 |
| InChIKey | VZIKSCSPHIKEHX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4-[3-(dibutylamino)propoxy]cyclohexa-2,4-diene-1-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-[3-(dibutylamino)propoxy]cyclohexa-2,4-diene-1-carbonyl chloride?
The IUPAC name of 1-chloro-4-[3-(dibutylamino)propoxy]cyclohexa-2,4-diene-1-carbonyl chloride (CID 87948387) is 1-chloro-4-[3-(dibutylamino)propoxy]cyclohexa-2,4-diene-1-carbonyl chloride.
What is the SMILES notation for 1-chloro-4-[3-(dibutylamino)propoxy]cyclohexa-2,4-diene-1-carbonyl chloride?
The canonical SMILES for 1-chloro-4-[3-(dibutylamino)propoxy]cyclohexa-2,4-diene-1-carbonyl chloride is CCCCN(CCCC)CCCOC1=CCC(Cl)(C(=O)Cl)C=C1.
What is the InChIKey of 1-chloro-4-[3-(dibutylamino)propoxy]cyclohexa-2,4-diene-1-carbonyl chloride?
The InChIKey is VZIKSCSPHIKEHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29Cl2NO2/c1-3-5-12-21(13-6-4-2)14-7-15-23-16-8-10-18(20,11-9-16)17(19)22/h8-10H,3-7,11-15H2,1-2H3.
What are the key properties of 1-chloro-4-[3-(dibutylamino)propoxy]cyclohexa-2,4-diene-1-carbonyl chloride?
1-chloro-4-[3-(dibutylamino)propoxy]cyclohexa-2,4-diene-1-carbonyl chloride has a molecular weight of 362.34 g/mol, XLogP of 4.88, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-[3-(dibutylamino)propoxy]cyclohexa-2,4-diene-1-carbonyl chloride is sourced from PubChem (CID 87948387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).