About (2-methyl-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium chloride
(2-methyl-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium chloride (PubChem CID 87948862) has the molecular formula C8H10ClN
and a molecular weight of 155.63 g/mol. Its IUPAC name is (2-methyl-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium chloride.
Molecular Properties
| Compound Name | (2-methyl-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium chloride |
| PubChem CID | 87948862 |
| Molecular Formula | C8H10ClN |
| Molecular Weight | 155.63 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | (2-methyl-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium chloride |
| SMILES | C=C1C=CC(=[NH2+])C(C)=C1.[Cl-] |
| InChI | InChI=1S/C8H9N.ClH/c1-6-3-4-8(9)7(2)5-6;/h3-5,9H,1H2,2H3;1H |
| InChIKey | QAIPGUWPIFNAIE-UHFFFAOYSA-N |
| XLogP | -2.74 |
| TPSA | 25.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.63 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium chloride?
The IUPAC name of (2-methyl-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium chloride (CID 87948862) is (2-methyl-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium chloride.
What is the SMILES notation for (2-methyl-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium chloride?
The canonical SMILES for (2-methyl-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium chloride is C=C1C=CC(=[NH2+])C(C)=C1.[Cl-].
What is the InChIKey of (2-methyl-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium chloride?
The InChIKey is QAIPGUWPIFNAIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N.ClH/c1-6-3-4-8(9)7(2)5-6;/h3-5,9H,1H2,2H3;1H.
What are the key properties of (2-methyl-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium chloride?
(2-methyl-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium chloride has a molecular weight of 155.63 g/mol, XLogP of -2.74, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium chloride is sourced from PubChem (CID 87948862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).