About ethanol;4-hydroxy-N-propylbutanamide;titanium
ethanol;4-hydroxy-N-propylbutanamide;titanium (PubChem CID 87948970) has the molecular formula C13H32NO5Ti-
and a molecular weight of 330.27 g/mol. Its IUPAC name is ethanol;4-hydroxy-N-propylbutanamide;titanium.
Molecular Properties
| Compound Name | ethanol;4-hydroxy-N-propylbutanamide;titanium |
| PubChem CID | 87948970 |
| Molecular Formula | C13H32NO5Ti- |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | ethanol;4-hydroxy-N-propylbutanamide;titanium |
| SMILES | CCO.CCO.CCO.[CH2-]CCNC(=O)CCCO.[Ti] |
| InChI | InChI=1S/C7H14NO2.3C2H6O.Ti/c1-2-5-8-7(10)4-3-6-9;3*1-2-3;/h9H,1-6H2,(H,8,10);3*3H,2H2,1H3;/q-1;;;; |
| InChIKey | LMESBCBLYPCTSR-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethanol;4-hydroxy-N-propylbutanamide;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;4-hydroxy-N-propylbutanamide;titanium?
The IUPAC name of ethanol;4-hydroxy-N-propylbutanamide;titanium (CID 87948970) is ethanol;4-hydroxy-N-propylbutanamide;titanium.
What is the SMILES notation for ethanol;4-hydroxy-N-propylbutanamide;titanium?
The canonical SMILES for ethanol;4-hydroxy-N-propylbutanamide;titanium is CCO.CCO.CCO.[CH2-]CCNC(=O)CCCO.[Ti].
What is the InChIKey of ethanol;4-hydroxy-N-propylbutanamide;titanium?
The InChIKey is LMESBCBLYPCTSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14NO2.3C2H6O.Ti/c1-2-5-8-7(10)4-3-6-9;3*1-2-3;/h9H,1-6H2,(H,8,10);3*3H,2H2,1H3;/q-1;;;;.
What are the key properties of ethanol;4-hydroxy-N-propylbutanamide;titanium?
ethanol;4-hydroxy-N-propylbutanamide;titanium has a molecular weight of 330.27 g/mol, XLogP of 0.09, 5 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;4-hydroxy-N-propylbutanamide;titanium is sourced from PubChem (CID 87948970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).