About bis(1-methoxyethoxy)alumanylium;hydride
bis(1-methoxyethoxy)alumanylium;hydride (PubChem CID 87949044) has the molecular formula C6H15AlO4
and a molecular weight of 178.16 g/mol. Its IUPAC name is bis(1-methoxyethoxy)alumanylium;hydride.
Molecular Properties
| Compound Name | bis(1-methoxyethoxy)alumanylium;hydride |
| PubChem CID | 87949044 |
| Molecular Formula | C6H15AlO4 |
| Molecular Weight | 178.16 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | bis(1-methoxyethoxy)alumanylium;hydride |
| SMILES | COC(C)O[Al+]OC(C)OC.[H-] |
| InChI | InChI=1S/2C3H7O2.Al.H/c2*1-3(4)5-2;;/h2*3H,1-2H3;;/q2*-1;+3;-1 |
| InChIKey | HTVUONYGLNKILU-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.16 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze bis(1-methoxyethoxy)alumanylium;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-methoxyethoxy)alumanylium;hydride?
The IUPAC name of bis(1-methoxyethoxy)alumanylium;hydride (CID 87949044) is bis(1-methoxyethoxy)alumanylium;hydride.
What is the SMILES notation for bis(1-methoxyethoxy)alumanylium;hydride?
The canonical SMILES for bis(1-methoxyethoxy)alumanylium;hydride is COC(C)O[Al+]OC(C)OC.[H-].
What is the InChIKey of bis(1-methoxyethoxy)alumanylium;hydride?
The InChIKey is HTVUONYGLNKILU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H7O2.Al.H/c2*1-3(4)5-2;;/h2*3H,1-2H3;;/q2*-1;+3;-1.
What are the key properties of bis(1-methoxyethoxy)alumanylium;hydride?
bis(1-methoxyethoxy)alumanylium;hydride has a molecular weight of 178.16 g/mol, XLogP of 0.65, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-methoxyethoxy)alumanylium;hydride is sourced from PubChem (CID 87949044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).