C23H27N2O2+ — CID 8794942
dimethyl-[(2S)-1-[(2-naphthalen-2-yloxyacetyl)amino]-3-phenylpropan-2-yl]azanium (PubChem CID 8794942) has the molecular formula C23H27N2O2+ and a molecular weight of 363.48 g/mol. Its IUPAC name is dimethyl-[(2S)-1-[(2-naphthalen-2-yloxyacetyl)amino]-3-phenylpropan-2-yl]azanium.
| Compound Name | dimethyl-[(2S)-1-[(2-naphthalen-2-yloxyacetyl)amino]-3-phenylpropan-2-yl]azanium |
|---|---|
| PubChem CID | 8794942 |
| Molecular Formula | C23H27N2O2+ |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | dimethyl-[(2S)-1-[(2-naphthalen-2-yloxyacetyl)amino]-3-phenylpropan-2-yl]azanium |
| SMILES | C[NH+](C)[C@H](CNC(=O)COc1ccc2ccccc2c1)Cc1ccccc1 |
| InChI | InChI=1S/C23H26N2O2/c1-25(2)21(14-18-8-4-3-5-9-18)16-24-23(26)17-27-22-13-12-19-10-6-7-11-20(19)15-22/h3-13,15,21H,14,16-17H2,1-2H3,(H,24,26)/p+1/t21-/m0/s1 |
| InChIKey | GWYANYMYGVCJIL-NRFANRHFSA-O |
| XLogP | 2.09 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |