About N,N'-bis(1-phenylethyl)-N,N'-bis(1-phenylethylideneamino)hexanediamide
N,N'-bis(1-phenylethyl)-N,N'-bis(1-phenylethylideneamino)hexanediamide (PubChem CID 87949537) has the molecular formula C38H42N4O2
and a molecular weight of 586.78 g/mol. Its IUPAC name is N,N'-bis(1-phenylethyl)-N,N'-bis(1-phenylethylideneamino)hexanediamide.
Molecular Properties
| Compound Name | N,N'-bis(1-phenylethyl)-N,N'-bis(1-phenylethylideneamino)hexanediamide |
| PubChem CID | 87949537 |
| Molecular Formula | C38H42N4O2 |
| Molecular Weight | 586.78 g/mol |
| Exact Mass | 586.33 |
| IUPAC Name | N,N'-bis(1-phenylethyl)-N,N'-bis(1-phenylethylideneamino)hexanediamide |
| SMILES | CC(=NN(C(=O)CCCCC(=O)N(N=C(C)c1ccccc1)C(C)c1ccccc1)C(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H42N4O2/c1-29(33-19-9-5-10-20-33)39-41(31(3)35-23-13-7-14-24-35)37(43)27-17-18-28-38(44)42(32(4)36-25-15-8-16-26-36)40-30(2)34-21-11-6-12-22-34/h5-16,19-26,31-32H,17-18,27-28H2,1-4H3 |
| InChIKey | CMIYTWHFLPMIBE-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 586.78 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(1-phenylethyl)-N,N'-bis(1-phenylethylideneamino)hexanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(1-phenylethyl)-N,N'-bis(1-phenylethylideneamino)hexanediamide?
The IUPAC name of N,N'-bis(1-phenylethyl)-N,N'-bis(1-phenylethylideneamino)hexanediamide (CID 87949537) is N,N'-bis(1-phenylethyl)-N,N'-bis(1-phenylethylideneamino)hexanediamide.
What is the SMILES notation for N,N'-bis(1-phenylethyl)-N,N'-bis(1-phenylethylideneamino)hexanediamide?
The canonical SMILES for N,N'-bis(1-phenylethyl)-N,N'-bis(1-phenylethylideneamino)hexanediamide is CC(=NN(C(=O)CCCCC(=O)N(N=C(C)c1ccccc1)C(C)c1ccccc1)C(C)c1ccccc1)c1ccccc1.
What is the InChIKey of N,N'-bis(1-phenylethyl)-N,N'-bis(1-phenylethylideneamino)hexanediamide?
The InChIKey is CMIYTWHFLPMIBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H42N4O2/c1-29(33-19-9-5-10-20-33)39-41(31(3)35-23-13-7-14-24-35)37(43)27-17-18-28-38(44)42(32(4)36-25-15-8-16-26-36)40-30(2)34-21-11-6-12-22-34/h5-16,19-26,31-32H,17-18,27-28H2,1-4H3.
What are the key properties of N,N'-bis(1-phenylethyl)-N,N'-bis(1-phenylethylideneamino)hexanediamide?
N,N'-bis(1-phenylethyl)-N,N'-bis(1-phenylethylideneamino)hexanediamide has a molecular weight of 586.78 g/mol, XLogP of 8.57, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(1-phenylethyl)-N,N'-bis(1-phenylethylideneamino)hexanediamide is sourced from PubChem (CID 87949537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).