C38H42N4O2 — CID 87949537
N,N'-bis(1-phenylethyl)-N,N'-bis(1-phenylethylideneamino)hexanediamide (PubChem CID 87949537) has the molecular formula C38H42N4O2 and a molecular weight of 586.78 g/mol. Its IUPAC name is N,N'-bis(1-phenylethyl)-N,N'-bis(1-phenylethylideneamino)hexanediamide.
| Compound Name | N,N'-bis(1-phenylethyl)-N,N'-bis(1-phenylethylideneamino)hexanediamide |
|---|---|
| PubChem CID | 87949537 |
| Molecular Formula | C38H42N4O2 |
| Molecular Weight | 586.78 g/mol |
| Exact Mass | 586.33 |
| IUPAC Name | N,N'-bis(1-phenylethyl)-N,N'-bis(1-phenylethylideneamino)hexanediamide |
| SMILES | CC(=NN(C(=O)CCCCC(=O)N(N=C(C)c1ccccc1)C(C)c1ccccc1)C(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H42N4O2/c1-29(33-19-9-5-10-20-33)39-41(31(3)35-23-13-7-14-24-35)37(43)27-17-18-28-38(44)42(32(4)36-25-15-8-16-26-36)40-30(2)34-21-11-6-12-22-34/h5-16,19-26,31-32H,17-18,27-28H2,1-4H3 |
| InChIKey | CMIYTWHFLPMIBE-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.78 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|