About 2-amino-N,N'-dimethylacetohydrazide;hydrochloride
2-amino-N,N'-dimethylacetohydrazide;hydrochloride (PubChem CID 87949719) has the molecular formula C4H12ClN3O
and a molecular weight of 153.61 g/mol. Its IUPAC name is 2-amino-N,N'-dimethylacetohydrazide;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-N,N'-dimethylacetohydrazide;hydrochloride |
| PubChem CID | 87949719 |
| Molecular Formula | C4H12ClN3O |
| Molecular Weight | 153.61 g/mol |
| Exact Mass | 153.07 |
| IUPAC Name | 2-amino-N,N'-dimethylacetohydrazide;hydrochloride |
| SMILES | CNN(C)C(=O)CN.Cl |
| InChI | InChI=1S/C4H11N3O.ClH/c1-6-7(2)4(8)3-5;/h6H,3,5H2,1-2H3;1H |
| InChIKey | QBXPGRMTMXFKKV-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.61 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N,N'-dimethylacetohydrazide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N,N'-dimethylacetohydrazide;hydrochloride?
The IUPAC name of 2-amino-N,N'-dimethylacetohydrazide;hydrochloride (CID 87949719) is 2-amino-N,N'-dimethylacetohydrazide;hydrochloride.
What is the SMILES notation for 2-amino-N,N'-dimethylacetohydrazide;hydrochloride?
The canonical SMILES for 2-amino-N,N'-dimethylacetohydrazide;hydrochloride is CNN(C)C(=O)CN.Cl.
What is the InChIKey of 2-amino-N,N'-dimethylacetohydrazide;hydrochloride?
The InChIKey is QBXPGRMTMXFKKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N3O.ClH/c1-6-7(2)4(8)3-5;/h6H,3,5H2,1-2H3;1H.
What are the key properties of 2-amino-N,N'-dimethylacetohydrazide;hydrochloride?
2-amino-N,N'-dimethylacetohydrazide;hydrochloride has a molecular weight of 153.61 g/mol, XLogP of -1.04, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N,N'-dimethylacetohydrazide;hydrochloride is sourced from PubChem (CID 87949719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).