About isothiocyanic acid;3-phenylpropylsulfanylbenzene
isothiocyanic acid;3-phenylpropylsulfanylbenzene (PubChem CID 87949810) has the molecular formula C16H17NS2
and a molecular weight of 287.45 g/mol. Its IUPAC name is isothiocyanic acid;3-phenylpropylsulfanylbenzene.
Molecular Properties
| Compound Name | isothiocyanic acid;3-phenylpropylsulfanylbenzene |
| PubChem CID | 87949810 |
| Molecular Formula | C16H17NS2 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | isothiocyanic acid;3-phenylpropylsulfanylbenzene |
| SMILES | N=C=S.c1ccc(CCCSc2ccccc2)cc1 |
| InChI | InChI=1S/C15H16S.CHNS/c1-3-8-14(9-4-1)10-7-13-16-15-11-5-2-6-12-15;2-1-3/h1-6,8-9,11-12H,7,10,13H2;2H |
| InChIKey | PGMHDFIVPBVWAR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze isothiocyanic acid;3-phenylpropylsulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isothiocyanic acid;3-phenylpropylsulfanylbenzene?
The IUPAC name of isothiocyanic acid;3-phenylpropylsulfanylbenzene (CID 87949810) is isothiocyanic acid;3-phenylpropylsulfanylbenzene.
What is the SMILES notation for isothiocyanic acid;3-phenylpropylsulfanylbenzene?
The canonical SMILES for isothiocyanic acid;3-phenylpropylsulfanylbenzene is N=C=S.c1ccc(CCCSc2ccccc2)cc1.
What is the InChIKey of isothiocyanic acid;3-phenylpropylsulfanylbenzene?
The InChIKey is PGMHDFIVPBVWAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16S.CHNS/c1-3-8-14(9-4-1)10-7-13-16-15-11-5-2-6-12-15;2-1-3/h1-6,8-9,11-12H,7,10,13H2;2H.
What are the key properties of isothiocyanic acid;3-phenylpropylsulfanylbenzene?
isothiocyanic acid;3-phenylpropylsulfanylbenzene has a molecular weight of 287.45 g/mol, XLogP of 5.08, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for isothiocyanic acid;3-phenylpropylsulfanylbenzene is sourced from PubChem (CID 87949810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).