C20H21NO3S — CID 87950783
2-[(4S)-2-oxo-1-[(4-phenoxyphenyl)methyl]piperidin-4-yl]ethanethioic S-acid (PubChem CID 87950783) has the molecular formula C20H21NO3S and a molecular weight of 355.46 g/mol. Its IUPAC name is 2-[(4S)-2-oxo-1-[(4-phenoxyphenyl)methyl]piperidin-4-yl]ethanethioic S-acid.
| Compound Name | 2-[(4S)-2-oxo-1-[(4-phenoxyphenyl)methyl]piperidin-4-yl]ethanethioic S-acid |
|---|---|
| PubChem CID | 87950783 |
| Molecular Formula | C20H21NO3S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 2-[(4S)-2-oxo-1-[(4-phenoxyphenyl)methyl]piperidin-4-yl]ethanethioic S-acid |
| SMILES | O=C(S)C[C@H]1CCN(Cc2ccc(Oc3ccccc3)cc2)C(=O)C1 |
| InChI | InChI=1S/C20H21NO3S/c22-19-12-16(13-20(23)25)10-11-21(19)14-15-6-8-18(9-7-15)24-17-4-2-1-3-5-17/h1-9,16H,10-14H2,(H,23,25)/t16-/m0/s1 |
| InChIKey | LGJFYIHLWWPXPS-INIZCTEOSA-N |
| XLogP | 4.06 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|