C34H36F3N3O4 — CID 87950914
(2,2,2-trifluoroacetyl) 3-[3-[[5-[2-(1-adamantyl)ethyl]-2-(2-methylphenyl)-1H-imidazole-4-carbonyl]amino]phenyl]propanoate (PubChem CID 87950914) has the molecular formula C34H36F3N3O4 and a molecular weight of 607.67 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-[3-[[5-[2-(1-adamantyl)ethyl]-2-(2-methylphenyl)-1H-imidazole-4-carbonyl]amino]phenyl]propanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-[3-[[5-[2-(1-adamantyl)ethyl]-2-(2-methylphenyl)-1H-imidazole-4-carbonyl]amino]phenyl]propanoate |
|---|---|
| PubChem CID | 87950914 |
| Molecular Formula | C34H36F3N3O4 |
| Molecular Weight | 607.67 g/mol |
| Exact Mass | 607.27 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-[3-[[5-[2-(1-adamantyl)ethyl]-2-(2-methylphenyl)-1H-imidazole-4-carbonyl]amino]phenyl]propanoate |
| SMILES | Cc1ccccc1-c1nc(C(=O)Nc2cccc(CCC(=O)OC(=O)C(F)(F)F)c2)c(CCC23CC4CC(CC(C4)C2)C3)[nH]1 |
| InChI | InChI=1S/C34H36F3N3O4/c1-20-5-2-3-8-26(20)30-39-27(11-12-33-17-22-13-23(18-33)15-24(14-22)19-33)29(40-30)31(42)38-25-7-4-6-21(16-25)9-10-28(41)44-32(43)34(35,36)37/h2-8,16,22-24H,9-15,17-19H2,1H3,(H,38,42)(H,39,40) |
| InChIKey | HOZXLXGHUCKVRU-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.67 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|