C27H24F3N3O4 — CID 87951395
ethyl 4-[3-[(Z)-hydrazinylidenemethyl]phenyl]-1-(naphthalen-2-ylmethyl)pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 87951395) has the molecular formula C27H24F3N3O4 and a molecular weight of 511.50 g/mol. Its IUPAC name is ethyl 4-[3-[(Z)-hydrazinylidenemethyl]phenyl]-1-(naphthalen-2-ylmethyl)pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl 4-[3-[(Z)-hydrazinylidenemethyl]phenyl]-1-(naphthalen-2-ylmethyl)pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87951395 |
| Molecular Formula | C27H24F3N3O4 |
| Molecular Weight | 511.50 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | ethyl 4-[3-[(Z)-hydrazinylidenemethyl]phenyl]-1-(naphthalen-2-ylmethyl)pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CCOC(=O)c1cn(Cc2ccc3ccccc3c2)cc1-c1cccc(/C=N\N)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H23N3O2.C2HF3O2/c1-2-30-25(29)24-17-28(15-19-10-11-20-7-3-4-8-21(20)13-19)16-23(24)22-9-5-6-18(12-22)14-27-26;3-2(4,5)1(6)7/h3-14,16-17H,2,15,26H2,1H3;(H,6,7)/b27-14-; |
| InChIKey | FRFWRDZGQNEBCI-JXTIHSCLSA-N |
| XLogP | 5.46 |
| TPSA | 106.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|